C7H11N3O4 — CID 171894981
methyl 3,4-dihydroxy-4-(1H-1,2,4-triazol-5-yl)butanoate (PubChem CID 171894981) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(1H-1,2,4-triazol-5-yl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(1H-1,2,4-triazol-5-yl)butanoate |
|---|---|
| PubChem CID | 171894981 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(1H-1,2,4-triazol-5-yl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ncn[nH]1 |
| InChI | InChI=1S/C7H11N3O4/c1-14-5(12)2-4(11)6(13)7-8-3-9-10-7/h3-4,6,11,13H,2H2,1H3,(H,8,9,10) |
| InChIKey | BSWMBULQJDSCNW-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |