C5H10N3O5P — CID 54104508
[2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propyl]phosphonic acid (PubChem CID 54104508) has the molecular formula C5H10N3O5P and a molecular weight of 223.12 g/mol. Its IUPAC name is [2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propyl]phosphonic acid.
| Compound Name | [2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propyl]phosphonic acid |
|---|---|
| PubChem CID | 54104508 |
| Molecular Formula | C5H10N3O5P |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | [2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propyl]phosphonic acid |
| SMILES | O=P(O)(O)CC(O)C(O)c1ncn[nH]1 |
| InChI | InChI=1S/C5H10N3O5P/c9-3(1-14(11,12)13)4(10)5-6-2-7-8-5/h2-4,9-10H,1H2,(H,6,7,8)(H2,11,12,13) |
| InChIKey | NCUILXBTWUXHHK-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|