C6H8N4O2 — CID 171900355
3,4-dihydroxy-4-(1H-1,2,4-triazol-5-yl)butanenitrile (PubChem CID 171900355) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(1H-1,2,4-triazol-5-yl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(1H-1,2,4-triazol-5-yl)butanenitrile |
|---|---|
| PubChem CID | 171900355 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 3,4-dihydroxy-4-(1H-1,2,4-triazol-5-yl)butanenitrile |
| SMILES | N#CCC(O)C(O)c1ncn[nH]1 |
| InChI | InChI=1S/C6H8N4O2/c7-2-1-4(11)5(12)6-8-3-9-10-6/h3-5,11-12H,1H2,(H,8,9,10) |
| InChIKey | FGUAJRMSLMMYJH-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |