C7H10N4S — CID 43368395
3-(1H-1,2,4-triazol-5-ylsulfanyl)pentanenitrile (PubChem CID 43368395) has the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-ylsulfanyl)pentanenitrile.
| Compound Name | 3-(1H-1,2,4-triazol-5-ylsulfanyl)pentanenitrile |
|---|---|
| PubChem CID | 43368395 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-ylsulfanyl)pentanenitrile |
| SMILES | CCC(CC#N)Sc1ncn[nH]1 |
| InChI | InChI=1S/C7H10N4S/c1-2-6(3-4-8)12-7-9-5-10-11-7/h5-6H,2-3H2,1H3,(H,9,10,11) |
| InChIKey | ABKDVXPTOIRFAA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |