C3H3F2N3S — CID 130656943
5-(difluoromethylsulfanyl)-1H-1,2,4-triazole (PubChem CID 130656943) has the molecular formula C3H3F2N3S and a molecular weight of 151.14 g/mol. Its IUPAC name is 5-(difluoromethylsulfanyl)-1H-1,2,4-triazole.
| Compound Name | 5-(difluoromethylsulfanyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 130656943 |
| Molecular Formula | C3H3F2N3S |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.00 |
| IUPAC Name | 5-(difluoromethylsulfanyl)-1H-1,2,4-triazole |
| SMILES | FC(F)Sc1ncn[nH]1 |
| InChI | InChI=1S/C3H3F2N3S/c4-2(5)9-3-6-1-7-8-3/h1-2H,(H,6,7,8) |
| InChIKey | XZWMRINAQPFQGU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |