C4H4N6S8 — CID 170702799
5-(1H-1,2,4-triazol-5-yloctasulfanyl)-1H-1,2,4-triazole (PubChem CID 170702799) has the molecular formula C4H4N6S8 and a molecular weight of 392.65 g/mol. Its IUPAC name is 5-(1H-1,2,4-triazol-5-yloctasulfanyl)-1H-1,2,4-triazole.
| Compound Name | 5-(1H-1,2,4-triazol-5-yloctasulfanyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 170702799 |
| Molecular Formula | C4H4N6S8 |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 391.83 |
| IUPAC Name | 5-(1H-1,2,4-triazol-5-yloctasulfanyl)-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(SSSSSSSSc2ncn[nH]2)n1 |
| InChI | InChI=1S/C4H4N6S8/c1-5-3(9-7-1)11-13-15-17-18-16-14-12-4-6-2-8-10-4/h1-2H,(H,5,7,9)(H,6,8,10) |
| InChIKey | IDEZSAUEDRLKGW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|