C9H6F3N3S — CID 22401460
5-[4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole (PubChem CID 22401460) has the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-[4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 22401460 |
| Molecular Formula | C9H6F3N3S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 5-[4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole |
| SMILES | FC(F)(F)c1ccc(Sc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C9H6F3N3S/c10-9(11,12)6-1-3-7(4-2-6)16-8-13-5-14-15-8/h1-5H,(H,13,14,15) |
| InChIKey | AGRKESGTLGOMCU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |