C8H6FN3S2 — CID 66561830
5-[(2-fluorophenyl)disulfanyl]-1H-1,2,4-triazole (PubChem CID 66561830) has the molecular formula C8H6FN3S2 and a molecular weight of 227.29 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)disulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(2-fluorophenyl)disulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 66561830 |
| Molecular Formula | C8H6FN3S2 |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 5-[(2-fluorophenyl)disulfanyl]-1H-1,2,4-triazole |
| SMILES | Fc1ccccc1SSc1ncn[nH]1 |
| InChI | InChI=1S/C8H6FN3S2/c9-6-3-1-2-4-7(6)13-14-8-10-5-11-12-8/h1-5H,(H,10,11,12) |
| InChIKey | UJKHMTRTRBERGN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|