C7H14N4S — CID 64704632
4-(1H-1,2,4-triazol-5-ylsulfanyl)pentan-2-amine (PubChem CID 64704632) has the molecular formula C7H14N4S and a molecular weight of 186.28 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-ylsulfanyl)pentan-2-amine.
| Compound Name | 4-(1H-1,2,4-triazol-5-ylsulfanyl)pentan-2-amine |
|---|---|
| PubChem CID | 64704632 |
| Molecular Formula | C7H14N4S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-ylsulfanyl)pentan-2-amine |
| SMILES | CC(N)CC(C)Sc1ncn[nH]1 |
| InChI | InChI=1S/C7H14N4S/c1-5(8)3-6(2)12-7-9-4-10-11-7/h4-6H,3,8H2,1-2H3,(H,9,10,11) |
| InChIKey | RYXHHNHPDZMKEI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |