About (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile
(3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile (PubChem CID 90050625) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile.
Molecular Properties
| Compound Name | (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile |
| PubChem CID | 90050625 |
| Molecular Formula | C5H7N5 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile |
| SMILES | N#CC[C@@H](N)c1ncn[nH]1 |
| InChI | InChI=1S/C5H7N5/c6-2-1-4(7)5-8-3-9-10-5/h3-4H,1,7H2,(H,8,9,10)/t4-/m1/s1 |
| InChIKey | VMPMLERFJPMYJE-SCSAIBSYSA-N |
| XLogP | -0.28 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile?
The IUPAC name of (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile (CID 90050625) is (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile.
What is the SMILES notation for (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile?
The canonical SMILES for (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile is N#CC[C@@H](N)c1ncn[nH]1.
What is the InChIKey of (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile?
The InChIKey is VMPMLERFJPMYJE-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H7N5/c6-2-1-4(7)5-8-3-9-10-5/h3-4H,1,7H2,(H,8,9,10)/t4-/m1/s1.
What are the key properties of (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile?
(3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile has a molecular weight of 137.15 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-3-(1H-1,2,4-triazol-5-yl)propanenitrile is sourced from PubChem (CID 90050625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).