C10H14N4OS — CID 170889850
1-[5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-yl]butan-2-amine (PubChem CID 170889850) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 1-[5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-yl]butan-2-amine.
| Compound Name | 1-[5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 170889850 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-[5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-yl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Sc2ncn[nH]2)o1 |
| InChI | InChI=1S/C10H14N4OS/c1-2-7(11)5-8-3-4-9(15-8)16-10-12-6-13-14-10/h3-4,6-7H,2,5,11H2,1H3,(H,12,13,14) |
| InChIKey | HCIMSHHDBBSUIR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |