C9H15NO2 — CID 170888411
[5-(2-aminobutyl)furan-2-yl]methanol (PubChem CID 170888411) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is [5-(2-aminobutyl)furan-2-yl]methanol.
| Compound Name | [5-(2-aminobutyl)furan-2-yl]methanol |
|---|---|
| PubChem CID | 170888411 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | [5-(2-aminobutyl)furan-2-yl]methanol |
| SMILES | CCC(N)Cc1ccc(CO)o1 |
| InChI | InChI=1S/C9H15NO2/c1-2-7(10)5-8-3-4-9(6-11)12-8/h3-4,7,11H,2,5-6,10H2,1H3 |
| InChIKey | CVBFHSFKWZPGBV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |