C10H18N2O — CID 170889541
5-(2-aminobutyl)-N,N-dimethylfuran-2-amine (PubChem CID 170889541) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 5-(2-aminobutyl)-N,N-dimethylfuran-2-amine.
| Compound Name | 5-(2-aminobutyl)-N,N-dimethylfuran-2-amine |
|---|---|
| PubChem CID | 170889541 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 5-(2-aminobutyl)-N,N-dimethylfuran-2-amine |
| SMILES | CCC(N)Cc1ccc(N(C)C)o1 |
| InChI | InChI=1S/C10H18N2O/c1-4-8(11)7-9-5-6-10(13-9)12(2)3/h5-6,8H,4,7,11H2,1-3H3 |
| InChIKey | LWDFXULIWDMVHB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |