C15H15ClF3NO — CID 170889110
1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]butan-2-amine (PubChem CID 170889110) has the molecular formula C15H15ClF3NO and a molecular weight of 317.74 g/mol. Its IUPAC name is 1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]butan-2-amine.
| Compound Name | 1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 170889110 |
| Molecular Formula | C15H15ClF3NO |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1 |
| InChI | InChI=1S/C15H15ClF3NO/c1-2-10(20)8-11-4-6-14(21-11)12-7-9(15(17,18)19)3-5-13(12)16/h3-7,10H,2,8,20H2,1H3 |
| InChIKey | MATJRCXURDEOJT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |