C16H15ClF3NO3 — CID 170884863
ethyl 2-amino-3-[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]propanoate (PubChem CID 170884863) has the molecular formula C16H15ClF3NO3 and a molecular weight of 361.75 g/mol. Its IUPAC name is ethyl 2-amino-3-[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]propanoate.
| Compound Name | ethyl 2-amino-3-[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]propanoate |
|---|---|
| PubChem CID | 170884863 |
| Molecular Formula | C16H15ClF3NO3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | ethyl 2-amino-3-[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(-c2ccc(C(F)(F)F)cc2Cl)o1 |
| InChI | InChI=1S/C16H15ClF3NO3/c1-2-23-15(22)13(21)8-10-4-6-14(24-10)11-5-3-9(7-12(11)17)16(18,19)20/h3-7,13H,2,8,21H2,1H3 |
| InChIKey | ACPSSQAFCRGXQJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |