C15H15ClN2O5 — CID 170885336
ethyl 2-amino-3-[5-(4-chloro-3-nitrophenyl)furan-2-yl]propanoate (PubChem CID 170885336) has the molecular formula C15H15ClN2O5 and a molecular weight of 338.75 g/mol. Its IUPAC name is ethyl 2-amino-3-[5-(4-chloro-3-nitrophenyl)furan-2-yl]propanoate.
| Compound Name | ethyl 2-amino-3-[5-(4-chloro-3-nitrophenyl)furan-2-yl]propanoate |
|---|---|
| PubChem CID | 170885336 |
| Molecular Formula | C15H15ClN2O5 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | ethyl 2-amino-3-[5-(4-chloro-3-nitrophenyl)furan-2-yl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(-c2ccc(Cl)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C15H15ClN2O5/c1-2-22-15(19)12(17)8-10-4-6-14(23-10)9-3-5-11(16)13(7-9)18(20)21/h3-7,12H,2,8,17H2,1H3 |
| InChIKey | DPAYSSJKVXYZBF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|