About 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine
4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine (PubChem CID 140508777) has the molecular formula C15H17F3N2O
and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine.
Molecular Properties
| Compound Name | 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine |
| PubChem CID | 140508777 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine |
| SMILES | NCCC(N)Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C15H17F3N2O/c16-15(17,18)11-3-1-2-10(8-11)14-5-4-13(21-14)9-12(20)6-7-19/h1-5,8,12H,6-7,9,19-20H2 |
| InChIKey | FJKDLULEVHREHR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine?
The IUPAC name of 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine (CID 140508777) is 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine.
What is the SMILES notation for 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine?
The canonical SMILES for 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine is NCCC(N)Cc1ccc(-c2cccc(C(F)(F)F)c2)o1.
What is the InChIKey of 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine?
The InChIKey is FJKDLULEVHREHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3N2O/c16-15(17,18)11-3-1-2-10(8-11)14-5-4-13(21-14)9-12(20)6-7-19/h1-5,8,12H,6-7,9,19-20H2.
What are the key properties of 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine?
4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine has a molecular weight of 298.31 g/mol, XLogP of 3.18, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]butane-1,3-diamine is sourced from PubChem (CID 140508777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).