About 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide
5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide (PubChem CID 91352888) has the molecular formula C21H22F3N3O3
and a molecular weight of 421.42 g/mol. Its IUPAC name is 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide |
| PubChem CID | 91352888 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide |
| SMILES | CC(N)CCCCc1onc(-c2ccc(-c3cccc(C(F)(F)F)c3)o2)c1C(N)=O |
| InChI | InChI=1S/C21H22F3N3O3/c1-12(25)5-2-3-8-16-18(20(26)28)19(27-30-16)17-10-9-15(29-17)13-6-4-7-14(11-13)21(22,23)24/h4,6-7,9-12H,2-3,5,8,25H2,1H3,(H2,26,28) |
| InChIKey | PQLZNGRDAFHQTR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide?
The IUPAC name of 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide (CID 91352888) is 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide?
The canonical SMILES for 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide is CC(N)CCCCc1onc(-c2ccc(-c3cccc(C(F)(F)F)c3)o2)c1C(N)=O.
What is the InChIKey of 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide?
The InChIKey is PQLZNGRDAFHQTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F3N3O3/c1-12(25)5-2-3-8-16-18(20(26)28)19(27-30-16)17-10-9-15(29-17)13-6-4-7-14(11-13)21(22,23)24/h4,6-7,9-12H,2-3,5,8,25H2,1H3,(H2,26,28).
What are the key properties of 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide?
5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide has a molecular weight of 421.42 g/mol, XLogP of 4.78, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-aminohexyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 91352888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).