C12H15BrN4S — CID 114062123
1-[5-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]butan-2-amine (PubChem CID 114062123) has the molecular formula C12H15BrN4S and a molecular weight of 327.25 g/mol. Its IUPAC name is 1-[5-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]butan-2-amine.
| Compound Name | 1-[5-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 114062123 |
| Molecular Formula | C12H15BrN4S |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1-[5-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(Br)ccc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C12H15BrN4S/c1-2-10(14)6-8-5-9(13)3-4-11(8)18-12-15-7-16-17-12/h3-5,7,10H,2,6,14H2,1H3,(H,15,16,17) |
| InChIKey | SZSONBSSFDJNAR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |