About [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine
[4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine (PubChem CID 63805586) has the molecular formula C9H9BrN4S
and a molecular weight of 285.17 g/mol. Its IUPAC name is [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine |
| PubChem CID | 63805586 |
| Molecular Formula | C9H9BrN4S |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine |
| SMILES | NCc1ccc(Br)cc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C9H9BrN4S/c10-7-2-1-6(4-11)8(3-7)15-9-12-5-13-14-9/h1-3,5H,4,11H2,(H,12,13,14) |
| InChIKey | JXRZMCMSPSDNCL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine?
The IUPAC name of [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine (CID 63805586) is [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine.
What is the SMILES notation for [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine?
The canonical SMILES for [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine is NCc1ccc(Br)cc1Sc1ncn[nH]1.
What is the InChIKey of [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine?
The InChIKey is JXRZMCMSPSDNCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN4S/c10-7-2-1-6(4-11)8(3-7)15-9-12-5-13-14-9/h1-3,5H,4,11H2,(H,12,13,14).
What are the key properties of [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine?
[4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine has a molecular weight of 285.17 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-2-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine is sourced from PubChem (CID 63805586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).