C10H13N3O4 — CID 171901346
4-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxybutanenitrile (PubChem CID 171901346) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901346 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 4-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxybutanenitrile |
| SMILES | COc1ncc(C(O)C(O)CC#N)c(OC)n1 |
| InChI | InChI=1S/C10H13N3O4/c1-16-9-6(5-12-10(13-9)17-2)8(15)7(14)3-4-11/h5,7-8,14-15H,3H2,1-2H3 |
| InChIKey | AZJHYRQHJIIFER-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |