C10H12N2O2 — CID 171900457
3,4-dihydroxy-4-(5-methyl-2-pyridinyl)butanenitrile (PubChem CID 171900457) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(5-methyl-2-pyridinyl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(5-methyl-2-pyridinyl)butanenitrile |
|---|---|
| PubChem CID | 171900457 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3,4-dihydroxy-4-(5-methyl-2-pyridinyl)butanenitrile |
| SMILES | Cc1ccc(C(O)C(O)CC#N)nc1 |
| InChI | InChI=1S/C10H12N2O2/c1-7-2-3-8(12-6-7)10(14)9(13)4-5-11/h2-3,6,9-10,13-14H,4H2,1H3 |
| InChIKey | RSRNQTINEMXVBH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |