C9H11N3O2 — CID 171900419
4-(6-amino-2-pyridinyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900419) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 4-(6-amino-2-pyridinyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(6-amino-2-pyridinyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900419 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 4-(6-amino-2-pyridinyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cccc(N)n1 |
| InChI | InChI=1S/C9H11N3O2/c10-5-4-7(13)9(14)6-2-1-3-8(11)12-6/h1-3,7,9,13-14H,4H2,(H2,11,12) |
| InChIKey | HWTSNJHVCJWLCB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |