C10H13N5 — CID 158710105
pentanedinitrile;pyridine-2,6-diamine (PubChem CID 158710105) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is pentanedinitrile;pyridine-2,6-diamine.
| Compound Name | pentanedinitrile;pyridine-2,6-diamine |
|---|---|
| PubChem CID | 158710105 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | pentanedinitrile;pyridine-2,6-diamine |
| SMILES | N#CCCCC#N.Nc1cccc(N)n1 |
| InChI | InChI=1S/C5H7N3.C5H6N2/c6-4-2-1-3-5(7)8-4;6-4-2-1-3-5-7/h1-3H,(H4,6,7,8);1-3H2 |
| InChIKey | IIPNFCKBLJAKAJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|