C12H12N2O — CID 121008202
5-(1,3-benzoxazol-2-yl)pentanenitrile (PubChem CID 121008202) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-2-yl)pentanenitrile.
| Compound Name | 5-(1,3-benzoxazol-2-yl)pentanenitrile |
|---|---|
| PubChem CID | 121008202 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 5-(1,3-benzoxazol-2-yl)pentanenitrile |
| SMILES | N#CCCCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C12H12N2O/c13-9-5-1-2-8-12-14-10-6-3-4-7-11(10)15-12/h3-4,6-7H,1-2,5,8H2 |
| InChIKey | BHBJQYYMCYCSSL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|