C17H16BrNO2 — CID 67403844
4-[4-(1,3-benzoxazol-2-yl)-1-bromobutyl]phenol (PubChem CID 67403844) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 4-[4-(1,3-benzoxazol-2-yl)-1-bromobutyl]phenol.
| Compound Name | 4-[4-(1,3-benzoxazol-2-yl)-1-bromobutyl]phenol |
|---|---|
| PubChem CID | 67403844 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 4-[4-(1,3-benzoxazol-2-yl)-1-bromobutyl]phenol |
| SMILES | Oc1ccc(C(Br)CCCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C17H16BrNO2/c18-14(12-8-10-13(20)11-9-12)4-3-7-17-19-15-5-1-2-6-16(15)21-17/h1-2,5-6,8-11,14,20H,3-4,7H2 |
| InChIKey | BUWYQAIMJXXART-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|