C9H12N4O2 — CID 171900776
4-(6-hydrazinyl-2-pyridinyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900776) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-(6-hydrazinyl-2-pyridinyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(6-hydrazinyl-2-pyridinyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900776 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-(6-hydrazinyl-2-pyridinyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cccc(NN)n1 |
| InChI | InChI=1S/C9H12N4O2/c10-5-4-7(14)9(15)6-2-1-3-8(12-6)13-11/h1-3,7,9,14-15H,4,11H2,(H,12,13) |
| InChIKey | BTOHHLGKTZJXGK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|