C9H14ClN3O2 — CID 171893610
4-chloro-1-(6-hydrazinyl-2-pyridinyl)butane-1,2-diol (PubChem CID 171893610) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is 4-chloro-1-(6-hydrazinyl-2-pyridinyl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(6-hydrazinyl-2-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893610 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-chloro-1-(6-hydrazinyl-2-pyridinyl)butane-1,2-diol |
| SMILES | NNc1cccc(C(O)C(O)CCCl)n1 |
| InChI | InChI=1S/C9H14ClN3O2/c10-5-4-7(14)9(15)6-2-1-3-8(12-6)13-11/h1-3,7,9,14-15H,4-5,11H2,(H,12,13) |
| InChIKey | VAZDDIYWFVRAJA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|