C8H10ClNO3 — CID 170817344
1-(6-chloro-2-pyridinyl)propane-1,2,3-triol (PubChem CID 170817344) has the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. Its IUPAC name is 1-(6-chloro-2-pyridinyl)propane-1,2,3-triol.
| Compound Name | 1-(6-chloro-2-pyridinyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817344 |
| Molecular Formula | C8H10ClNO3 |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1-(6-chloro-2-pyridinyl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C8H10ClNO3/c9-7-3-1-2-5(10-7)8(13)6(12)4-11/h1-3,6,8,11-13H,4H2 |
| InChIKey | UKQLWUUTKDAKQN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|