C7H9ClN2O — CID 14578852
2-amino-1-(6-chloro-2-pyridinyl)ethanol (PubChem CID 14578852) has the molecular formula C7H9ClN2O and a molecular weight of 172.62 g/mol. Its IUPAC name is 2-amino-1-(6-chloro-2-pyridinyl)ethanol.
| Compound Name | 2-amino-1-(6-chloro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 14578852 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2-amino-1-(6-chloro-2-pyridinyl)ethanol |
| SMILES | NCC(O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C7H9ClN2O/c8-7-3-1-2-5(10-7)6(11)4-9/h1-3,6,11H,4,9H2 |
| InChIKey | NMJFNAFTBJFGAK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|