C10H15ClN2O — CID 165348764
2-amino-1-(6-chloro-2-pyridinyl)pentan-1-ol (PubChem CID 165348764) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 2-amino-1-(6-chloro-2-pyridinyl)pentan-1-ol.
| Compound Name | 2-amino-1-(6-chloro-2-pyridinyl)pentan-1-ol |
|---|---|
| PubChem CID | 165348764 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-amino-1-(6-chloro-2-pyridinyl)pentan-1-ol |
| SMILES | CCCC(N)C(O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C10H15ClN2O/c1-2-4-7(12)10(14)8-5-3-6-9(11)13-8/h3,5-7,10,14H,2,4,12H2,1H3 |
| InChIKey | CZZNMRZKKOYOAH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|