C8H11ClN2O3 — CID 170817506
1-(5-amino-6-chloro-2-pyridinyl)propane-1,2,3-triol (PubChem CID 170817506) has the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. Its IUPAC name is 1-(5-amino-6-chloro-2-pyridinyl)propane-1,2,3-triol.
| Compound Name | 1-(5-amino-6-chloro-2-pyridinyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817506 |
| Molecular Formula | C8H11ClN2O3 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1-(5-amino-6-chloro-2-pyridinyl)propane-1,2,3-triol |
| SMILES | Nc1ccc(C(O)C(O)CO)nc1Cl |
| InChI | InChI=1S/C8H11ClN2O3/c9-8-4(10)1-2-5(11-8)7(14)6(13)3-12/h1-2,6-7,12-14H,3,10H2 |
| InChIKey | SJUDYGZJTCMZHW-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|