C9H13ClN2O2S — CID 171873736
1-(5-amino-6-chloro-2-pyridinyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873736) has the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. Its IUPAC name is 1-(5-amino-6-chloro-2-pyridinyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(5-amino-6-chloro-2-pyridinyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873736 |
| Molecular Formula | C9H13ClN2O2S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-(5-amino-6-chloro-2-pyridinyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Nc1ccc(C(O)C(O)CCS)nc1Cl |
| InChI | InChI=1S/C9H13ClN2O2S/c10-9-5(11)1-2-6(12-9)8(14)7(13)3-4-15/h1-2,7-8,13-15H,3-4,11H2 |
| InChIKey | GJAGCTAEXIMBQO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|