C10H16N2O2S — CID 171873763
1-(6-amino-4-methyl-2-pyridinyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873763) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 1-(6-amino-4-methyl-2-pyridinyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(6-amino-4-methyl-2-pyridinyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873763 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-(6-amino-4-methyl-2-pyridinyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Cc1cc(N)nc(C(O)C(O)CCS)c1 |
| InChI | InChI=1S/C10H16N2O2S/c1-6-4-7(12-9(11)5-6)10(14)8(13)2-3-15/h4-5,8,10,13-15H,2-3H2,1H3,(H2,11,12) |
| InChIKey | DNHJZLQYRJWGOY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|