C7H8Cl2N2O — CID 130618210
(2S)-2-amino-2-(5,6-dichloro-2-pyridinyl)ethanol (PubChem CID 130618210) has the molecular formula C7H8Cl2N2O and a molecular weight of 207.06 g/mol. Its IUPAC name is (2S)-2-amino-2-(5,6-dichloro-2-pyridinyl)ethanol.
| Compound Name | (2S)-2-amino-2-(5,6-dichloro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 130618210 |
| Molecular Formula | C7H8Cl2N2O |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | (2S)-2-amino-2-(5,6-dichloro-2-pyridinyl)ethanol |
| SMILES | N[C@H](CO)c1ccc(Cl)c(Cl)n1 |
| InChI | InChI=1S/C7H8Cl2N2O/c8-4-1-2-6(5(10)3-12)11-7(4)9/h1-2,5,12H,3,10H2/t5-/m1/s1 |
| InChIKey | HQXJMNIBJTVRFH-RXMQYKEDSA-N |
| XLogP | 1.38 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|