C9H11N3O — CID 76847412
2-amino-2-(1H-pyrrolo[3,2-b]pyridin-5-yl)ethanol (PubChem CID 76847412) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-amino-2-(1H-pyrrolo[3,2-b]pyridin-5-yl)ethanol.
| Compound Name | 2-amino-2-(1H-pyrrolo[3,2-b]pyridin-5-yl)ethanol |
|---|---|
| PubChem CID | 76847412 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2-amino-2-(1H-pyrrolo[3,2-b]pyridin-5-yl)ethanol |
| SMILES | NC(CO)c1ccc2[nH]ccc2n1 |
| InChI | InChI=1S/C9H11N3O/c10-6(5-13)7-1-2-8-9(12-7)3-4-11-8/h1-4,6,11,13H,5,10H2 |
| InChIKey | WATWRBDFANKFSH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |