C8H9ClFNO2 — CID 171861504
3-chloro-1-(6-fluoro-2-pyridinyl)propane-1,2-diol (PubChem CID 171861504) has the molecular formula C8H9ClFNO2 and a molecular weight of 205.62 g/mol. Its IUPAC name is 3-chloro-1-(6-fluoro-2-pyridinyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(6-fluoro-2-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171861504 |
| Molecular Formula | C8H9ClFNO2 |
| Molecular Weight | 205.62 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 3-chloro-1-(6-fluoro-2-pyridinyl)propane-1,2-diol |
| SMILES | OC(CCl)C(O)c1cccc(F)n1 |
| InChI | InChI=1S/C8H9ClFNO2/c9-4-6(12)8(13)5-2-1-3-7(10)11-5/h1-3,6,8,12-13H,4H2 |
| InChIKey | DPPJEOSAWNCSCD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.62 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|