C15H21BN2O4 — CID 171902005
3,4-dihydroxy-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]butanenitrile (PubChem CID 171902005) has the molecular formula C15H21BN2O4 and a molecular weight of 304.16 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]butanenitrile.
| Compound Name | 3,4-dihydroxy-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]butanenitrile |
|---|---|
| PubChem CID | 171902005 |
| Molecular Formula | C15H21BN2O4 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3,4-dihydroxy-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]butanenitrile |
| SMILES | CC1(C)OB(c2ccc(C(O)C(O)CC#N)nc2)OC1(C)C |
| InChI | InChI=1S/C15H21BN2O4/c1-14(2)15(3,4)22-16(21-14)10-5-6-11(18-9-10)13(20)12(19)7-8-17/h5-6,9,12-13,19-20H,7H2,1-4H3 |
| InChIKey | NORZNCICAOJESH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|