About 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile
4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900676) has the molecular formula C10H11FN2O2
and a molecular weight of 210.21 g/mol. Its IUPAC name is 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile.
Molecular Properties
| Compound Name | 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile |
| PubChem CID | 171900676 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile |
| SMILES | Cc1cc(F)cnc1C(O)C(O)CC#N |
| InChI | InChI=1S/C10H11FN2O2/c1-6-4-7(11)5-13-9(6)10(15)8(14)2-3-12/h4-5,8,10,14-15H,2H2,1H3 |
| InChIKey | KMPUDHJUMZTRKS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile?
The IUPAC name of 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile (CID 171900676) is 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile.
What is the SMILES notation for 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile?
The canonical SMILES for 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile is Cc1cc(F)cnc1C(O)C(O)CC#N.
What is the InChIKey of 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile?
The InChIKey is KMPUDHJUMZTRKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O2/c1-6-4-7(11)5-13-9(6)10(15)8(14)2-3-12/h4-5,8,10,14-15H,2H2,1H3.
What are the key properties of 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile?
4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile has a molecular weight of 210.21 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoro-3-methyl-2-pyridinyl)-3,4-dihydroxybutanenitrile is sourced from PubChem (CID 171900676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).