C10H12N2O3 — CID 171900762
3,4-dihydroxy-4-(2-methoxy-4-pyridinyl)butanenitrile (PubChem CID 171900762) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-methoxy-4-pyridinyl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(2-methoxy-4-pyridinyl)butanenitrile |
|---|---|
| PubChem CID | 171900762 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3,4-dihydroxy-4-(2-methoxy-4-pyridinyl)butanenitrile |
| SMILES | COc1cc(C(O)C(O)CC#N)ccn1 |
| InChI | InChI=1S/C10H12N2O3/c1-15-9-6-7(3-5-12-9)10(14)8(13)2-4-11/h3,5-6,8,10,13-14H,2H2,1H3 |
| InChIKey | ZNGDULIZZFIQEE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |