C13H13N3O2 — CID 171901720
3,4-dihydroxy-4-(5-phenyl-1H-pyrazol-4-yl)butanenitrile (PubChem CID 171901720) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(5-phenyl-1H-pyrazol-4-yl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(5-phenyl-1H-pyrazol-4-yl)butanenitrile |
|---|---|
| PubChem CID | 171901720 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3,4-dihydroxy-4-(5-phenyl-1H-pyrazol-4-yl)butanenitrile |
| SMILES | N#CCC(O)C(O)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C13H13N3O2/c14-7-6-11(17)13(18)10-8-15-16-12(10)9-4-2-1-3-5-9/h1-5,8,11,13,17-18H,6H2,(H,15,16) |
| InChIKey | RLYJRSXJIWDEFX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |