C12H10ClN3O2 — CID 171871621
3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2,3-dihydroxypropanenitrile (PubChem CID 171871621) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2,3-dihydroxypropanenitrile.
| Compound Name | 3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171871621 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClN3O2/c13-8-3-1-7(2-4-8)11-9(6-15-16-11)12(18)10(17)5-14/h1-4,6,10,12,17-18H,(H,15,16) |
| InChIKey | VKZHLBKSUQMMRI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|