C12H12ClN3O3 — CID 171869553
3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2,3-dihydroxypropanamide (PubChem CID 171869553) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2,3-dihydroxypropanamide.
| Compound Name | 3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869553 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClN3O3/c13-7-3-1-6(2-4-7)9-8(5-15-16-9)10(17)11(18)12(14)19/h1-5,10-11,17-18H,(H2,14,19)(H,15,16) |
| InChIKey | JTSCMSSJOPAEQM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |