C12H11ClN2O2 — CID 22831657
ethyl 5-(4-chlorophenyl)-1H-pyrazole-4-carboxylate (PubChem CID 22831657) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22831657 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN2O2/c1-2-17-12(16)10-7-14-15-11(10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3,(H,14,15) |
| InChIKey | DGCNYRAFLBXEPV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |