C13H13FN2O3 — CID 75523916
2-fluoroethyl 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylate (PubChem CID 75523916) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 2-fluoroethyl 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylate.
| Compound Name | 2-fluoroethyl 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 75523916 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-fluoroethyl 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylate |
| SMILES | COc1ccc(-c2[nH]ncc2C(=O)OCCF)cc1 |
| InChI | InChI=1S/C13H13FN2O3/c1-18-10-4-2-9(3-5-10)12-11(8-15-16-12)13(17)19-7-6-14/h2-5,8H,6-7H2,1H3,(H,15,16) |
| InChIKey | OBHXBCCOMLOQQB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |