C5H9N4O5P — CID 54558123
[3-nitrosooxy-3-(1H-1,2,4-triazol-5-yl)propyl]phosphonic acid (PubChem CID 54558123) has the molecular formula C5H9N4O5P and a molecular weight of 236.12 g/mol. Its IUPAC name is [3-nitrosooxy-3-(1H-1,2,4-triazol-5-yl)propyl]phosphonic acid.
| Compound Name | [3-nitrosooxy-3-(1H-1,2,4-triazol-5-yl)propyl]phosphonic acid |
|---|---|
| PubChem CID | 54558123 |
| Molecular Formula | C5H9N4O5P |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | [3-nitrosooxy-3-(1H-1,2,4-triazol-5-yl)propyl]phosphonic acid |
| SMILES | O=NOC(CCP(=O)(O)O)c1ncn[nH]1 |
| InChI | InChI=1S/C5H9N4O5P/c10-9-14-4(1-2-15(11,12)13)5-6-3-7-8-5/h3-4H,1-2H2,(H,6,7,8)(H2,11,12,13) |
| InChIKey | ZOPLQBMVIIBYJP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 137.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|