C10H16N6O3P+ — CID 57256431
oxo-bis[1-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium (PubChem CID 57256431) has the molecular formula C10H16N6O3P+ and a molecular weight of 299.25 g/mol. Its IUPAC name is oxo-bis[1-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium.
| Compound Name | oxo-bis[1-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium |
|---|---|
| PubChem CID | 57256431 |
| Molecular Formula | C10H16N6O3P+ |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | oxo-bis[1-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium |
| SMILES | CCC(O[P+](=O)OC(CC)c1ncn[nH]1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H16N6O3P/c1-3-7(9-11-5-13-15-9)18-20(17)19-8(4-2)10-12-6-14-16-10/h5-8H,3-4H2,1-2H3,(H,11,13,15)(H,12,14,16)/q+1 |
| InChIKey | UYVICQJISGMVPF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|