About 2-(1H-1,2,4-triazol-5-yl)butanoic acid
2-(1H-1,2,4-triazol-5-yl)butanoic acid (PubChem CID 71650519) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(1H-1,2,4-triazol-5-yl)butanoic acid |
| PubChem CID | 71650519 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1ncn[nH]1 |
| InChI | InChI=1S/C6H9N3O2/c1-2-4(6(10)11)5-7-3-8-9-5/h3-4H,2H2,1H3,(H,10,11)(H,7,8,9) |
| InChIKey | CWPPFGCQHSERBR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-1,2,4-triazol-5-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-1,2,4-triazol-5-yl)butanoic acid?
The IUPAC name of 2-(1H-1,2,4-triazol-5-yl)butanoic acid (CID 71650519) is 2-(1H-1,2,4-triazol-5-yl)butanoic acid.
What is the SMILES notation for 2-(1H-1,2,4-triazol-5-yl)butanoic acid?
The canonical SMILES for 2-(1H-1,2,4-triazol-5-yl)butanoic acid is CCC(C(=O)O)c1ncn[nH]1.
What is the InChIKey of 2-(1H-1,2,4-triazol-5-yl)butanoic acid?
The InChIKey is CWPPFGCQHSERBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-2-4(6(10)11)5-7-3-8-9-5/h3-4H,2H2,1H3,(H,10,11)(H,7,8,9).
What are the key properties of 2-(1H-1,2,4-triazol-5-yl)butanoic acid?
2-(1H-1,2,4-triazol-5-yl)butanoic acid has a molecular weight of 155.16 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-1,2,4-triazol-5-yl)butanoic acid is sourced from PubChem (CID 71650519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).