C9H19N5 — CID 105230629
[3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentyl]hydrazine (PubChem CID 105230629) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is [3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentyl]hydrazine.
| Compound Name | [3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105230629 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | [3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentyl]hydrazine |
| SMILES | CCC(CC)CC(NN)c1ncn[nH]1 |
| InChI | InChI=1S/C9H19N5/c1-3-7(4-2)5-8(13-10)9-11-6-12-14-9/h6-8,13H,3-5,10H2,1-2H3,(H,11,12,14) |
| InChIKey | JTSVIGQIUDIPKG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|