C9H11BrN6 — CID 105230433
[2-(5-bromo-2-pyridinyl)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydrazine (PubChem CID 105230433) has the molecular formula C9H11BrN6 and a molecular weight of 283.13 g/mol. Its IUPAC name is [2-(5-bromo-2-pyridinyl)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(5-bromo-2-pyridinyl)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105230433 |
| Molecular Formula | C9H11BrN6 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | [2-(5-bromo-2-pyridinyl)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Br)cn1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H11BrN6/c10-6-1-2-7(12-4-6)3-8(15-11)9-13-5-14-16-9/h1-2,4-5,8,15H,3,11H2,(H,13,14,16) |
| InChIKey | BYMZULDGBKGKMU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|